PRODUCT Properties
| Melting point: | 160-164 °C (lit.) |
| Boiling point: | 480.6±40.0 °C(Predicted) |
| Density | 1.469±0.06 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| pka | 2.95±0.10(Predicted) |
| form | solid |
| Appearance | White to off-white Solid |
| BRN | 2387319 |
| InChI | 1S/C14H10Cl2O3/c15-11-7-3-1-5-9(11)14(19,13(17)18)10-6-2-4-8-12(10)16/h1-8,19H,(H,17,18) |
| InChIKey | OJYHUFNZIWRMPT-UHFFFAOYSA-N |
| SMILES | OC(=O)C(O)(c1ccccc1Cl)c2ccccc2Cl |
Description and Uses
2,2-Bis(2-chlorophenyl)-2-hydroxyacetic Acid is a useful intermediate in the synthesis of substituted benzilic acid derivatives with antimicrobial properties.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H400 |
| Precautionary statements | P261-P264-P271-P273-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,N |
| Risk Statements | 36/37/38-50/53 |
| Safety Statements | 26-36-60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |








