A3162312
Diphenylacetic acid , 98% , 117-34-0
CAS NO.:117-34-0
Empirical Formula: C14H12O2
Molecular Weight: 212.24
MDL number: MFCD00004251
EINECS: 204-185-0
| Pack Size | Price | Stock | Quantity |
| 25G | RMB37.60 | In Stock |
|
| 100G | RMB88.80 | In Stock |
|
| 250g | RMB215.20 | In Stock |
|
| 500G | RMB428.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 147-149 °C(lit.) |
| Boiling point: | 195°C 25mm |
| Density | 1,257 g/cm3 |
| vapor pressure | 0.001Pa at 25℃ |
| refractive index | 1.6000 (estimate) |
| Flash point: | 195°C/25mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 0.13g/l |
| pka | 3.94(at 25℃) |
| form | Crystalline Powder |
| color | White to creamy-white |
| PH | 3.8 (H2O, 20℃)(saturated solution) |
| Water Solubility | Slightly soluble in water(0.13g/L). |
| Merck | 14,3316 |
| BRN | 1910978 |
| InChI | 1S/C14H12O2/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H,(H,15,16) |
| InChIKey | PYHXGXCGESYPCW-UHFFFAOYSA-N |
| SMILES | OC(=O)C(c1ccccc1)c2ccccc2 |
| LogP | 3.17 at 25℃ |
| CAS DataBase Reference | 117-34-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzeneacetic acid, «alpha»-phenyl-(117-34-0) |
| EPA Substance Registry System | Benzeneacetic acid, .alpha.-phenyl- (117-34-0) |
Description and Uses
Kinetic resolution of racemic 1-heteroarylalkanols by asymmetric esterification using diphenylacetic acid with pivalic anhydride and a chiral acyl-transfer catalyst is described. Molecular crystal of acridine and diphenylacetic acid and its absolute asymmetric photodecarboxylating condensation generates chirality in a two-component. The activation parameters for the racemization of a series of ortho-alkyl-substituted diphenylacetic acids are determined.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319-H412 |
| Precautionary statements | P264-P270-P273-P280-P301+P312-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/38-36/37/38 |
| Safety Statements | 24/25-36/37-26 |
| WGK Germany | 2 |
| RTECS | AH2515000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Eye Irrit. 2 |
| Toxicity | mouse,LD50,intraperitoneal,500mg/kg (500mg/kg),Farmaco, Edizione Scientifica. Vol. 13, Pg. 286, 1958. |






