PRODUCT Properties
| Melting point: | 172-175 °C (lit.) |
| Boiling point: | 300 °C (lit.) |
| Density | 1.0891 (rough estimate) |
| refractive index | 1.6530 (estimate) |
| storage temp. | Store at room temperature |
| form | powder to crystal |
| pka | 4.78±0.10(Predicted) |
| color | White to Almost white |
| InChI | 1S/C15H14O2/c1-15(14(16)17,12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3,(H,16,17) |
| InChIKey | ODELFXJUOVNEFZ-UHFFFAOYSA-N |
| SMILES | CC(C(O)=O)(c1ccccc1)c2ccccc2 |
| CAS DataBase Reference | 5558-66-7(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
