A2510012
3-Cyano-2-fluoropyridine , 98% , 3939-13-7
Synonym(s):
3-Cyano-2-fluoropyridine
CAS NO.:3939-13-7
Empirical Formula: C6H3FN2
Molecular Weight: 122.1
MDL number: MFCD03095082
EINECS: 678-765-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB47.20 | In Stock |
|
| 25G | RMB231.20 | In Stock |
|
| 100G | RMB762.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 27-30°C |
| Boiling point: | 214.6±20.0 °C(Predicted) |
| Density | 1.24±0.1 g/cm3(Predicted) |
| Flash point: | 98℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | -3.88±0.10(Predicted) |
| form | powder to lump |
| color | White to Dark green |
| BRN | 386567 |
| InChI | InChI=1S/C6H3FN2/c7-6-5(4-8)2-1-3-9-6/h1-3H |
| InChIKey | USIDQCCXMGJOJM-UHFFFAOYSA-N |
| SMILES | C1(F)=NC=CC=C1C#N |
| CAS DataBase Reference | 3939-13-7(CAS DataBase Reference) |
Description and Uses
3-Cyano-2-fluoropyridine have been successfully used in preparation of compounds with diverse spectrum of biological activity. Other 3-cyano-2-fluoropyridine can potentially be used as promising agents for the positron emission tomography (PET). Additionally, it has previously been demonstrated that 3-cyanopyridines can be transformed into -amides, -carboxylic acids, and -esters.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38-5-36/38-22 |
| Safety Statements | 26-36/37/39-36-24/25-23-3 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 |






