A2526112
4-Chloro-2-methylquinoline , ≥98% , 4295-06-1
CAS NO.:4295-06-1
Empirical Formula: C10H8ClN
Molecular Weight: 177.63
MDL number: MFCD00006757
EINECS: 224-300-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB88.00 | In Stock |
|
| 5G | RMB214.40 | In Stock |
|
| 25G | RMB844.80 | In Stock |
|
| 100G | RMB2950.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 39 °C |
| Boiling point: | 269-270 °C (lit.) |
| Density | 0.881 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 4.40±0.50(Predicted) |
| form | powder to lump to clear liquid |
| color | White or Colorless to Yellow |
| Water Solubility | Slightly soluble in water. |
| BRN | 3522 |
| InChI | InChI=1S/C10H8ClN/c1-7-6-9(11)8-4-2-3-5-10(8)12-7/h2-6H,1H3 |
| InChIKey | HQAIROMRVBVWSK-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2)C(Cl)=CC=1C |
| CAS DataBase Reference | 4295-06-1(CAS DataBase Reference) |
Description and Uses
4-Chloroquinaldine is used in the preparation of 4-phenyl-hydrazinoquinaldine
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2933499090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






