A2560312
1,3-Cyclopentanediol (<i>cis</i>- and <i>trans</i>- mixture) , >95.0%(GC) , 59719-74-3
CAS NO.：59719-74-3
Empirical Formula: C5H10O2
Molecular Weight: 102.13
MDL number: MFCD00001367
EINECS: 261-880-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB143.20 | In Stock |
|
| 1G | RMB298.40 | In Stock |
|
| 5g | RMB847.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 40 °C(lit.) |
| Boiling point: | 80-85 °C0.1 mm Hg(lit.) |
| Density | 1.094 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 0-6°C |
| form | Liquid After Melting |
| pka | 14.65±0.40(Predicted) |
| color | Clear colorless to slightly yellow |
| InChI | InChI=1S/C5H10O2/c6-4-1-2-5(7)3-4/h4-7H,1-3H2 |
| InChIKey | NUUPJBRGQCEZSI-UHFFFAOYSA-N |
| SMILES | C1(O)CCC(O)C1 |
Description and Uses
1,3-Cyclopentanediol was used in the synthesis of 1,3-cyclopentanediol bis(4-methylbenzenesulfonate) and β-hydroxy-substituted cyclic carbonyl compounds. It was also used in direct enantiomer resolution of diols without derivatization on a chiral polysiloxane by capillary gas chromatography.
Safety
| Symbol(GHS) |  GHS02 |
| Signal word | Danger |
| Hazard statements | H225 |
| Precautionary statements | P210-P273-P243-P403 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29061990 |
