A2576012
Cefmetazole Sodium Salt , >97.0%(T) , 56796-39-5
CAS NO.:56796-39-5
Empirical Formula: C15H16N7O5S3.Na
Molecular Weight: 493.52
MDL number: MFCD00214260
EINECS: 627-393-7
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB319.20 | In Stock |
|
| 1G | RMB1087.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >130°C (dec.) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | H2O: soluble50mg/mL |
| form | powder |
| color | White to Off-White |
| Water Solubility | Soluble in water |
| Sensitive | Hygroscopic |
| Merck | 14,1926 |
| Stability: | Hygroscopic |
| InChIKey | BITQGIOJQWZUPL-PBCQUBLHSA-M |
| SMILES | [Na+].[H][C@]12SCC(CSc3nnnn3C)=C(N1C(=O)[C@]2(NC(=O)CSCC#N)OC)C([O-])=O |
| CAS DataBase Reference | 56796-39-5(CAS DataBase Reference) |
Description and Uses
Semi-synthetic antibiotic derived from Cephamycin. Antibacterial
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H315-H317-H319-H334-H335 |
| Precautionary statements | P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-42/43 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| RTECS | XI0372200 |
| HS Code | 2941.90.3000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| Toxicity | LD50 i.v. in rats: >5000 mg/kg (Masuda) |






