A2576912
<i>cis</i>-3-Hexenyl <i>cis</i>-3-Hexenoate , 0 , 61444-38-0
CAS NO.:61444-38-0
Empirical Formula: C12H20O2
Molecular Weight: 196.29
MDL number: MFCD00036652
EINECS: 262-797-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB103.20 | In Stock |
|
| 250mg | RMB199.20 | In Stock |
|
| 5G | RMB319.20 | In Stock |
|
| 25g | RMB799.20 | In Stock |
|
| 100g | RMB2559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 60 °C0.5 mm Hg(lit.) |
| Density | 0.907 g/mL at 25 °C(lit.) |
| vapor pressure | 3.9Pa at 25℃ |
| FEMA | 3689 | CIS-3-HEXENYL CIS-3-HEXENOATE |
| refractive index | n |
| Flash point: | 210 °F |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Odor | at 100.00 %. green tomato leaf pear melon metallic fennel tropical |
| Odor Type | green |
| biological source | synthetic |
| JECFA Number | 336 |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C12H20O2/c1-3-5-7-9-11-14-12(13)10-8-6-4-2/h5-8H,3-4,9-11H2,1-2H3/b7-5-,8-6- |
| InChIKey | UZJQQWFHPLYECS-SFECMWDFSA-N |
| SMILES | [H]\C(CC)=C(/[H])CCOC(=O)C\C([H])=C(\[H])CC |
| LogP | 4.01 at 30℃ |
| EPA Substance Registry System | 3-Hexenoic acid, (3Z)-3-hexenyl ester, (3Z)- (61444-38-0) |
Description and Uses
cis-3-Hexenyl cis-3-hexenoate has a green grass, tomato green, violet leaf green odor.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H361-H372-H410 |
| Precautionary statements | P273-P201-P264-P280-P301+P330+P331-P312 |
| PPE | Eyeshields, Gloves |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29161900 |
| Storage Class | 10 - Combustible liquids |








