PRODUCT Properties
| Melting point: | 157-159 °C (lit.) |
| Boiling point: | 252.42°C (rough estimate) |
| Density | 1.3647 (rough estimate) |
| refractive index | 1.7200 (estimate) |
| storage temp. | 2-8°C, protect from light |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 7.46±0.40(Predicted) |
| form | powder to crystal |
| color | White to Orange to Green |
| Water Solubility | SOLUBLE IN HOT WATER |
| InChI | InChI=1S/C6H4ClN3/c7-4-1-2-5-6(3-4)9-10-8-5/h1-3H,(H,8,9,10) |
| InChIKey | PZBQVZFITSVHAW-UHFFFAOYSA-N |
| SMILES | N1C2=CC(Cl)=CC=C2N=N1 |
| CAS DataBase Reference | 94-97-3(CAS DataBase Reference) |
| EPA Substance Registry System | 1H-Benzotriazole, 5-chloro- (94-97-3) |
Description and Uses
5-Chlorobenzotriazole is a good inhibitor; it decreases anodic and cathodic reaction rates, and the highest inhibition efficiency was 91.2%. The inhibitory effect of 5-chlorobenzotriazole is explained by the formation of the layer on the copper surface.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-37 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
