A2594912
6-Chloro-3-formylchromone , >98.0%(GC) , 42248-31-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB61.60 | In Stock |
|
| 5G | RMB198.40 | In Stock |
|
| 25G | RMB712.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 166-168 °C(lit.) |
| Boiling point: | 351.9±42.0 °C(Predicted) |
| Density | 1.561±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, stored under nitrogen |
| form | powder to crystal |
| color | Light orange to Yellow to Green |
| InChI | InChI=1S/C10H5ClO3/c11-7-1-2-9-8(3-7)10(13)6(4-12)5-14-9/h1-5H |
| InChIKey | LIGLNCRTMDRUAO-UHFFFAOYSA-N |
| SMILES | C1OC2=CC=C(Cl)C=C2C(=O)C=1C=O |
| CAS DataBase Reference | 42248-31-7(CAS DataBase Reference) |






