A2597512
Cyclopropanecarboxamidine Hydrochloride , >97.0% , 57297-29-7
Synonym(s):
Cyclopropanecarbamidine hydrochloride;Cyclopropyl-1-carbamidine hydrochloride
CAS NO.:57297-29-7
Empirical Formula: C4H9ClN2
Molecular Weight: 120.58
MDL number: MFCD00053010
EINECS: 611-495-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB84.80 | In Stock |
|
| 10G | RMB132.80 | In Stock |
|
| 25G | RMB237.60 | In Stock |
|
| 100G | RMB943.20 | In Stock |
|
| 500g | RMB3314.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 123 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| Water Solubility | Soluble in water |
| form | powder to crystal |
| color | White to Almost white |
| Sensitive | Hygroscopic |
| BRN | 4507255 |
| InChI | InChI=1S/C4H8N2.ClH/c5-4(6)3-1-2-3;/h3H,1-2H2,(H3,5,6);1H |
| InChIKey | JRYOZJIRAVZGMV-UHFFFAOYSA-N |
| SMILES | C1(C(N)=N)CC1.[H]Cl |
| CAS DataBase Reference | 57297-29-7(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Hygroscopic |
| HazardClass | IRRITANT |
| HS Code | 29252900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







