A2601712
4'-Cyanoacetophenone , >97.0%(GC) , 1443-80-7
Synonym(s):
4′-Cyanoacetophenone
CAS NO.:1443-80-7
Empirical Formula: C9H7NO
Molecular Weight: 145.16
MDL number: MFCD00001825
EINECS: 215-885-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB47.20 | In Stock |
|
| 25G | RMB196.00 | In Stock |
|
| 100G | RMB668.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 56-59 °C(lit.) |
| Boiling point: | 95-96°C 14mm |
| Density | 1.1555 (rough estimate) |
| vapor pressure | 0.856Pa at 25℃ |
| refractive index | 1.4500 (estimate) |
| Flash point: | 95-96°C/14mm |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform |
| form | Crystalline Mass or Crystalline Powder and Chunks |
| color | Light yellow to yellow-beige |
| Water Solubility | Soluble in chloroform. Insoluble in water. |
| BRN | 1932887 |
| InChI | InChI=1S/C9H7NO/c1-7(11)9-4-2-8(6-10)3-5-9/h2-5H,1H3 |
| InChIKey | NLPHXWGWBKZSJC-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(C(C)=O)C=C1 |
| LogP | 1.531 at 25℃ |
| CAS DataBase Reference | 1443-80-7(CAS DataBase Reference) |
Description and Uses
4-Acetylbenzonitrile is used in the preparation of antimalarial isonitriles. It is also used for synthetic API such as anesthetic agents and anti-allergic agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312 |
| Precautionary statements | P264-P270-P280-P301+P312-P302+P352+P312-P362+P364 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38-20/21/22 |
| Safety Statements | 36-36/37/39-26-22 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Oral |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






