A2623512
6-Chloro-1,2,3,4-tetrahydrocarbazole , >98.0% , 36684-65-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB177.60 | In Stock |
|
| 5G | RMB804.00 | In Stock |
|
| 25G | RMB2854.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 145-148 °C (lit.) |
| Boiling point: | 358.8±37.0 °C(Predicted) |
| Density | 1.280 |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | slightly sol. in Methanol |
| form | powder to crystal |
| pka | 16.93±0.20(Predicted) |
| color | White to Light yellow |
| λmax | 292nm(ethylene glycol)(lit.) |
| InChI | InChI=1S/C12H12ClN/c13-8-5-6-12-10(7-8)9-3-1-2-4-11(9)14-12/h5-7,14H,1-4H2 |
| InChIKey | CNQQPGJXOHSTQR-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(Cl)C=C2)C2=C1CCCC2 |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2933.99.8290 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






