A2626912
5'-Chloro-2'-hydroxy-3'-nitroacetophenone , >98.0% , 84942-40-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB39.20 | In Stock |
|
| 5G | RMB155.52 | In Stock |
|
| 25G | RMB319.20 | In Stock |
|
| 100g | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 132-135 °C(lit.) |
| storage temp. | RT, stored under nitrogen |
| form | powder to crystal |
| color | White to Yellow to Orange |
| InChI | 1S/C8H6ClNO4/c1-4(11)6-2-5(9)3-7(8(6)12)10(13)14/h2-3,12H,1H3 |
| InChIKey | IUNBIQBAYUBIFD-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc(Cl)cc(c1O)[N+]([O-])=O |
| CAS DataBase Reference | 84942-40-5(CAS DataBase Reference) |
Description and Uses
5′-Chloro-2′-hydroxy-3′-nitroacetophenone may be used for the synthesis of 6-chloro-8-nitro-4-oxo-4H-chromene-3-carbaldehyde.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2914390090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
