A2630712
Chlorodi(<i>p</i>-tolyl)phosphine , ≥96.0%(T) , 1019-71-2
CAS NO.:1019-71-2
Empirical Formula: C14H14ClP
Molecular Weight: 248.69
MDL number: MFCD01630844
EINECS: 202-848-9
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB83.20 | In Stock |
|
| 250mg | RMB227.20 | In Stock |
|
| 1G | RMB671.20 | In Stock |
|
| 5g | RMB1567.20 | In Stock |
|
| 25g | RMB5487.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 180-184℃/10mm |
| Density | 1.1 g/mL at 25 °C |
| refractive index | n20/D1.501 |
| storage temp. | 2-8°C |
| form | liquid |
| Appearance | Colorless to light yellow Viscous Liquid |
| Water Solubility | Reacts with water. |
| Sensitive | Air & Moisture Sensitive |
| InChI | InChI=1S/C14H14ClP/c1-11-3-7-13(8-4-11)16(15)14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
| InChIKey | BJBXRRHIBSXGLF-UHFFFAOYSA-N |
| SMILES | P(C1=CC=C(C)C=C1)(C1=CC=C(C)C=C1)Cl |
Description and Uses
Chlorodi(p-tolyl)phosphine is used as a reactant for synthesis of palladium catalysts for C-C bond forming cross-coupling reactions, ligands for nickel(0)-catalyzed isomerization reactions, phosphinosulfonamide nickel complexes for oligomerization reactions. It is a reactant for phosphinylation reactions.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 14-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8 / PGIII |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | II |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |






