F764923
Chlorobis(4-methoxyphenyl)phosphine , 98+ , 13685-30-8
Synonym(s):
P,P-Bis(4-methoxyphenyl)phosphinous chloride
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1636.80 | In Stock |
|
| 5g | RMB4745.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 61-64℃ |
| Boiling point: | 140°C/1.5mm |
| Flash point: | 140°C/1.5mm |
| form | solid |
| Water Solubility | Reacts with water. |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C14H14ClO2P/c1-16-11-3-7-13(8-4-11)18(15)14-9-5-12(17-2)6-10-14/h3-10H,1-2H3 |
| InChIKey | YTFQUBRFOJIJOZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(cc1)P(Cl)c2ccc(OC)cc2 |
Description and Uses
Chlorobis(4-methoxyphenyl)phosphine is used an pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN3265 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
