S6060249
Bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine , 95% , 136802-85-2
CAS NO.：136802-85-2
Empirical Formula: C18H22ClO2P
Molecular Weight: 336.79
MDL number: MFCD01630810
| Pack Size | Price | Stock | Quantity |
| 1g | RMB656.70 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 451.7±45.0 °C(Predicted) |
| Density | 1.141 g/cm3 at 25 °C |
| refractive index | n20/D1.597 |
| Flash point: | >110℃ |
| form | liquid |
| color | colorless, viscous |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C18H22ClO2P/c1-11-7-15(8-12(2)17(11)20-5)22(19)16-9-13(3)18(21-6)14(4)10-16/h7-10H,1-6H3 |
| InChIKey | JWCZKGYRAINWJA-UHFFFAOYSA-N |
| SMILES | P(C1=CC(C)=C(OC)C(C)=C1)(C1=CC(C)=C(OC)C(C)=C1)Cl |
Description and Uses
Reactant for:
- Asymmetric organocatalytic electrophilic phosphination
- Asymmetric hydroformulation using Taddol-based chiral phosphine-phosphite ligands
- Synthesis of ferrocene-based chiral diphosphines
- Alcoholysis of phosphane-boranes
- Asymmetric hydrogenations of bifep-type biferrocenes
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-43-45 |
| RIDADR | UN3265 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | II |
