A2632412
4-Chloro-7-chlorosulfonyl-2,1,3-benzoxadiazole [Bifunctional Fluorescent Reagent] , >97.0%(T) , 142246-48-8
CAS NO.:142246-48-8
Empirical Formula: C6H2Cl2N2O3S
Molecular Weight: 253.06
MDL number: MFCD00191405
| Pack Size | Price | Stock | Quantity |
| 200MG | RMB199.20 | In Stock |
|
| 250mg | RMB255.20 | In Stock |
|
| 1G | RMB879.20 | In Stock |
|
| 5G | RMB1908.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 85.0 to 89.0 °C |
| Boiling point: | 361.7±45.0 °C(Predicted) |
| Density | 1.789±0.06 g/cm3(Predicted) |
| storage temp. | room temp |
| pka | -6.24±0.50(Predicted) |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| λmax | 324 nm |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C6H2Cl2N2O3S/c7-3-1-2-4(14(8,11)12)6-5(3)9-13-10-6/h1-2H |
| InChIKey | BPPRLMZEVZSIIJ-UHFFFAOYSA-N |
| SMILES | Clc1ccc(c2nonc12)S(Cl)(=O)=O |
| CAS DataBase Reference | 142246-48-8 |
Description and Uses
Bifunctional fluorescent reagent. Cross-linking reagent
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xi,C |
| Risk Statements | 34 |
| Safety Statements | 36/37/39-45-26 |
| RIDADR | 3261 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 2934999090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |

![4-Chloro-7-chlorosulfonyl-2,1,3-benzoxadiazole [Bifunctional Fluorescent Reagent]](https://img.chemicalbook.com/CAS/GIF/142246-48-8.gif)

![DAABD-Cl [=4-[2-(Dimethylamino)ethylaminosulfonyl]-7-chloro-2,1,3-benzoxadiazole] [for Proteome Analysis]](https://img.chemicalbook.com/CAS/GIF/664985-43-7.gif)


![Benzo[c][1,2,5]oxadiazole-4-sulfonylchloride](https://img.chemicalbook.com/CAS/GIF/114322-14-4.gif)