A2670012
3-<WBR>Carbamoyl-<WBR>pyrrolidine-<WBR>1-<WBR>carboxylic acid tert-butyl ester , 97% , 122684-34-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB166.48 | In Stock |
|
| 1G | RMB653.04 | In Stock |
|
| 5g | RMB2000.80 | In Stock |
|
| 10g | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 117.0 to 121.0 °C |
| Boiling point: | 370.1±31.0 °C(Predicted) |
| Density | 1.155±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 16.40±0.20(Predicted) |
| color | White to Almost white |
| InChI | 1S/C10H18N2O3/c1-10(2,3)15-9(14)12-5-4-7(6-12)8(11)13/h7H,4-6H2,1-3H3,(H2,11,13) |
| InChIKey | NHDGOVOBEZPXMY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)C(N)=O |
| CAS DataBase Reference | 122684-34-8(CAS DataBase Reference) |
Description and Uses
tert-Butyl 3-Carbamoylpyrrolidine-1-carboxylate is used for preparation and sulfuration of 1,2,4-thiadiazoles.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
