A2692012
3-<WBR>Cyano-<WBR>4-<WBR>methylcoumarin , 97% , 24526-69-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB157.60 | In Stock |
|
| 5G | RMB551.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 192-195 °C (dec.) (lit.) |
| Boiling point: | 352.2±21.0 °C(Predicted) |
| Density | 1.29±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| InChI | 1S/C11H7NO2/c1-7-8-4-2-3-5-10(8)14-11(13)9(7)6-12/h2-5H,1H3 |
| InChIKey | FFBLBFMTKGSSPY-UHFFFAOYSA-N |
| SMILES | CC1=C(C#N)C(=O)Oc2ccccc12 |
| CAS DataBase Reference | 24526-69-0(CAS DataBase Reference) |
Description and Uses
4-Methyl-2-oxo-2H-chromene-3-carbonitrile is a useful reactant for various organic reaction and synthesis of organic compounds.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2932209090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
