A2733412
3-chloro-5-methoxypyridazine , 97% , 123696-02-6
CAS NO.：123696-02-6
Empirical Formula: C5H5ClN2O
Molecular Weight: 144.56
MDL number: MFCD08236839
EINECS: 200-001-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB106.40 | In Stock |
|
| 1G | RMB304.00 | In Stock |
|
| 5g | RMB965.60 | In Stock |
|
| 10g | RMB2073.60 | In Stock |
|
| 25g | RMB4983.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 285 ºC |
| Density | 1.292 |
| Flash point: | 126 ºC |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 2.45±0.10(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C5H5ClN2O/c1-9-4-2-5(6)8-7-3-4/h2-3H,1H3 |
| InChIKey | XLGRINRFBNCHQS-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NN=CC(OC)=C1 |
Description and Uses
3-Chloro-5-methoxypyridazine is used to synthesize potent and selective inhibitors of glycogen synthase kinase 3 with good cellular efficacy.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2933998090 |
