A3102612
2,3-Difluoro-5-chloropyridine , 98% , 89402-43-7
CAS NO.:89402-43-7
Empirical Formula: C5H2ClF2N
Molecular Weight: 149.53
MDL number: MFCD04039314
EINECS: 410-090-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB29.60 | In Stock |
|
| 25G | RMB85.60 | In Stock |
|
| 100g | RMB270.40 | In Stock |
|
| 500g | RMB1244.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 47-49 C |
| Boiling point: | 135°C |
| Density | 1.442 g/mL at 25 °C |
| refractive index | 1.4738 |
| Flash point: | 135°C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | -5.14±0.20(Predicted) |
| form | Oil |
| color | Clear Colourless |
| BRN | 4177319 |
| InChI | InChI=1S/C5H2ClF2N/c6-3-1-4(7)5(8)9-2-3/h1-2H |
| InChIKey | PERMDYZFNQIKBL-UHFFFAOYSA-N |
| SMILES | C1(F)=NC=C(Cl)C=C1F |
| CAS DataBase Reference | 89402-43-7(CAS DataBase Reference) |
Description and Uses
5-Chloro-2,3-difluoropyridine is a 2,3,5-trihalopyridine used in the preparation of the herbicides and pesticides such as chodinafop-propargyl.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H302-H412 |
| Precautionary statements | P210-P273-P301+P312+P330 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-52/53-10-36/37/38-20/21/22 |
| Safety Statements | 23-36-61-26 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 2933399990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Flam. Liq. 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






