A3112112
3-(3,4-Dimethoxyphenyl)propionic acid , 98% , 2107-70-2
Synonym(s):
3,4-Dimethoxyhydrocinnamic acid
CAS NO.:2107-70-2
Empirical Formula: C11H14O4
Molecular Weight: 210.23
MDL number: MFCD00002774
EINECS: 218-288-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB68.00 | In Stock |
|
| 100G | RMB205.60 | In Stock |
|
| 500g | RMB731.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 96-97 °C(lit.) |
| Boiling point: | 309.75°C (rough estimate) |
| Density | 1.1922 (rough estimate) |
| refractive index | 1.5384 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO, Water |
| pka | 4.71±0.10(Predicted) |
| form | Crystalline Powder |
| color | Slightly beige |
| BRN | 2696272 |
| InChI | InChI=1S/C11H14O4/c1-14-9-5-3-8(4-6-11(12)13)7-10(9)15-2/h3,5,7H,4,6H2,1-2H3,(H,12,13) |
| InChIKey | LHHKQWQTBCTDQM-UHFFFAOYSA-N |
| SMILES | C1(CCC(O)=O)=CC=C(OC)C(OC)=C1 |
| CAS DataBase Reference | 2107-70-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-(3,4-Dimethoxyphenyl)-propionic acid(2107-70-2) |
Description and Uses
3-(3,4-Dimethoxyphenyl)propionic acid was used in screening of short-chain fatty acid derivatives for the ability to induce γ globin gene expression in reporter assays and erythropoiesis in vivo.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29189090 |
| Storage Class | 11 - Combustible Solids |






