A3115712
Diethyl iminodiacetate , 98% , 6290-05-7
CAS NO.：6290-05-7
Empirical Formula: C8H15NO4
Molecular Weight: 189.21
MDL number: MFCD00041925
EINECS: 228-533-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB28.80 | In Stock |
|
| 25G | RMB68.00 | In Stock |
|
| 100G | RMB164.80 | In Stock |
|
| 500g | RMB650.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 208 °C (lit.) |
| Density | 1.056 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 4.92±0.20(Predicted) |
| form | Viscous Liquid |
| color | Clear light yellow to yellow |
| Water Solubility | Moderately soluble in water. |
| InChI | InChI=1S/C8H15NO4/c1-3-12-7(10)5-9-6-8(11)13-4-2/h9H,3-6H2,1-2H3 |
| InChIKey | LJDNMOCAQVXVKY-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)CNCC(OCC)=O |
| CAS DataBase Reference | 6290-05-7(CAS DataBase Reference) |
| EPA Substance Registry System | Glycine, N-(2-ethoxy-2-oxoethyl)-, ethyl ester (6290-05-7) |
Description and Uses
It is mainly used for the manufacture of N-(Phosphonomethyl) iminodiacetic acid and glyphosate. Used as raw material for ion exchange resin; for rubbers, electroplating and food additives.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | 1993 |
| WGK Germany | 3 |
| TSCA | Yes |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29252900 |
