A3434012
Di-<i>tert</i>-butyl Iminodiacetate , >97.0%(GC) , 85916-13-8
| Pack Size | Price | Stock | Quantity |
| 200MG | RMB76.00 | In Stock |
|
| 1G | RMB242.40 | In Stock |
|
| 5G | RMB852.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 38-42 °C(lit.) |
| Boiling point: | 298.0±25.0 °C(Predicted) |
| Density | 1.011±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | 2-8°C(protect from light) |
| solubility | Methanol[soluble in] |
| solubility | soluble in Methanol |
| form | powder to lump to clear liquid |
| pka | 4.52±0.20(Predicted) |
| color | White or Colorless to Almost white or Almost colorless |
| InChI | 1S/C12H23NO4/c1-11(2,3)16-9(14)7-13-8-10(15)17-12(4,5)6/h13H,7-8H2,1-6H3 |
| InChIKey | SMXMBXPLRFTROI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CNCC(=O)OC(C)(C)C |
Description and Uses
Di-tert-butyl iminodiacetate may be used as a reagent in the synthesis of:
- multi-carboxylic acid-containing carbocyanine dyes
- monosubstituted difunctionalized polyhedral oligomeric silsesquioxanes (POSS) monomers
- multigenerational fluorinated dendrimers
- 2,6-dipyrazol-1-ylpyridine derivatives
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







