A3159912
4,6-Dimethyl-2-pyrimidinethiol , 98% , 22325-27-5
CAS NO.:22325-27-5
Empirical Formula: C6H8N2S
Molecular Weight: 140.21
MDL number: MFCD00006079
EINECS: 244-911-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB37.60 | In Stock |
|
| 10G | RMB59.20 | In Stock |
|
| 25G | RMB84.00 | In Stock |
|
| 100G | RMB232.80 | In Stock |
|
| 500G | RMB1039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 213-216 °C (dec.)(lit.) |
| Boiling point: | 212.9±23.0 °C(Predicted) |
| Density | 1.160 (estimate) |
| refractive index | 1.5047 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 8.46±0.10(Predicted) |
| form | solid |
| color | White to Yellow |
| BRN | 81330 |
| InChI | InChI=1S/C6H8N2S/c1-4-3-5(2)8-6(9)7-4/h3H,1-2H3,(H,7,8,9) |
| InChIKey | RAFAYWADRVMWFA-UHFFFAOYSA-N |
| SMILES | C1(=S)NC(C)=CC(C)=N1 |
| CAS DataBase Reference | 22325-27-5(CAS DataBase Reference) |
Description and Uses
4,6-Dimethyl-2-mercaptopyrimidine is used in the synthesis of pharmaceutical and pesticide intermediates.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P280g-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | UW5650000 |
| HS Code | 29335995 |






