A3160912
2,2'-Dipyridylamine , 99% , 1202-34-2
Synonym(s):
2,2′-Dipyridylamine;2,2’-DIPYRIDYLAMINE;bipyam
CAS NO.:1202-34-2
Empirical Formula: C10H9N3
Molecular Weight: 171.2
MDL number: MFCD00006247
EINECS: 214-864-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB122.40 | In Stock |
|
| 5G | RMB370.40 | In Stock |
|
| 25G | RMB1293.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90-92 °C(lit.) |
| Boiling point: | 222 °C50 mm Hg(lit.) |
| Density | 1.1984 (rough estimate) |
| refractive index | 1.6550 (estimate) |
| Flash point: | 170 °C |
| storage temp. | 2-8°C |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.79±0.10(Predicted) |
| color | White to Off-White |
| BRN | 127131 |
| InChI | InChI=1S/C10H9N3/c1-3-7-11-9(5-1)13-10-6-2-4-8-12-10/h1-8H,(H,11,12,13) |
| InChIKey | HMMPCBAWTWYFLR-UHFFFAOYSA-N |
| SMILES | C1(NC2=NC=CC=C2)=NC=CC=C1 |
| CAS DataBase Reference | 1202-34-2(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Pyridinamine, N-2-pyridinyl- (1202-34-2) |
Description and Uses
2,2′-Dipyridylamine (bipyam) can be used:
- As a bidentate N-donor ligand in the synthesis of various metal complexes.
- To synthesize Pd-polyoxovanadates, heterogeneous catalyst for the oxidation of benzylic hydrocarbons.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 3545 |
| WGK Germany | 3 |
| RTECS | UR3545000 |
| HS Code | 29333990 |



![7-Bromo-1-methyl-1H-imidazo[4,5-c]pyridine](https://img.chemicalbook.com/CAS/GIF/317840-04-3.gif)


