Daidzein , ≥98% , 486-66-8
Synonym(s):
Daidzein;Isoaurostatin;4?,7-Dihydroxyisoflavone, Casein Kinase II Inhibitor X;4′,7-Dihydroxy-iso-flavone;7-Hydroxy-3-(4-hydroxy-phenyl)-4H-1-benzo-pyran-4-one
CAS NO.：486-66-8
Empirical Formula: C15H10O4
Molecular Weight: 254.24
MDL number: MFCD00016954
EINECS: 207-635-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB25.60 | In Stock |
|
| 5G | RMB37.60 | In Stock |
|
| 25G | RMB141.60 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 315-323°C (dec.) |
| Boiling point: | 317.45°C (rough estimate) |
| Density | 1.1629 (rough estimate) |
| refractive index | 1.4300 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO: 10 mg/mL |
| pka | 7.01±0.20(Predicted) |
| form | Powder |
| color | White to off-white |
| biological source | synthetic |
| Water Solubility | insoluble |
| Merck | 14,2801 |
| BRN | 231523 |
| Major Application | food and beverages |
| Cosmetics Ingredients Functions | SKIN CONDITIONING - MISCELLANEOUS |
| InChI | 1S/C15H10O4/c16-10-3-1-9(2-4-10)13-8-19-14-7-11(17)5-6-12(14)15(13)18/h1-8,16-17H |
| InChIKey | ZQSIJRDFPHDXIC-UHFFFAOYSA-N |
| SMILES | Oc1ccc(cc1)C2=COc3cc(O)ccc3C2=O |
| LogP | 2.632 (est) |
| CAS DataBase Reference | 486-66-8(CAS DataBase Reference) |
| EPA Substance Registry System | 4H-1-Benzopyran-4-one, 7-hydroxy-3-(4-hydroxyphenyl)- (486-66-8) |
Description and Uses
Daidzein is an isoflavone phytoestrogenic compound that has been found in soybeans and other legumes. It binds to estrogen receptor β (ERβ; Ki = 2.8 μM) but not ERα at concentrations up to 1 mM. It is estrogenic in vitro, increasing gene transcription mediated by the estrogen response element (ERE) in a reporter assay in an ERβ-dependent manner (EC50 = 2.8 μM for MCF-7 cells expressing ERβ). Daidzein is an inhibitor of carbonic anhydrase (CA) that is selective for carbonic CAVII and CAXII (Kis = 4.2 and 56 nM, respectively) over CAI, II, and IV (Kis = >10,000, >10,000, and 718.7 nM, respectively). It reduces tumor growth in a PC3 prostate cancer mouse orthotopic model when administered at a dose of 50 mg/kg per day and potentiates the effects of radiation therapy.
phytoestrogen
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/38 |
| Safety Statements | 24-26-37/39 |
| WGK Germany | 3 |
| RTECS | DJ3100040 |
| HazardClass | IRRITANT |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
