A3169912
Diisopropyl phthalate , 98% , 605-45-8
Synonym(s):
1,2-Benzenedicarboxylic acid 1,2-bis(1-methylethyl) ester;NSC 15315;Phthalic acid diisopropyl ester
CAS NO.：605-45-8
Empirical Formula: C14H18O4
Molecular Weight: 250.29
MDL number: MFCD00053717
EINECS: 210-086-3
| Pack Size | Price | Stock | Quantity |
| 5ml | RMB92.80 | In Stock |
|
| 25ML | RMB379.20 | In Stock |
|
| 100ML | RMB965.60 | In Stock |
|
| 500ml | RMB3599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 20 °C |
| Boiling point: | 313.42°C (rough estimate) |
| Density | 1.063 g/mL at 20 °C(lit.) |
| refractive index | n |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Liquid |
| color | Colourless |
| Water Solubility | 332.9mg/L(20 ºC) |
| BRN | 1972723 |
| Major Application | environmental |
| InChI | 1S/C14H18O4/c1-9(2)17-13(15)11-7-5-6-8-12(11)14(16)18-10(3)4/h5-10H,1-4H3 |
| InChIKey | QWDBCIAVABMJPP-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)c1ccccc1C(=O)OC(C)C |
| EPA Substance Registry System | Diisopropyl phthalate (605-45-8) |
Description and Uses
Diisopropyl phthalate may be used as an analytical standard for the determination of the analyte in meter dose inhalers (MDI) and children′s plastic toys by gas chromatography-tandem mass spectrometry (GC-MS/MS) technique.
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H351 |
| Precautionary statements | P201-P302+P352-P305+P351+P338-P308+P313 |
| target organs | Respiratory system |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-40 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| RTECS | TI1350000 |
| TSCA | TSCA listed |
| HS Code | 2917.34.0150 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Carc. 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
