A3175612
2,2-Difluoro-1,3-benzodioxole , 95% , 1583-59-1
CAS NO.：1583-59-1
Empirical Formula: C7H4F2O2
Molecular Weight: 158.1
MDL number: MFCD00236217
EINECS: 216-431-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB65.60 | In Stock |
|
| 25G | RMB173.60 | In Stock |
|
| 100G | RMB504.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 129-130°C |
| Density | 1,308 g/cm3 |
| refractive index | 1.443 |
| Flash point: | 129-130°C |
| storage temp. | 2-8°C |
| solubility | Chloroform, Methanol |
| form | Oil |
| color | Clear Colourless |
| BRN | 1307648 |
| InChI | InChI=1S/C7H4F2O2/c8-7(9)10-5-3-1-2-4-6(5)11-7/h1-4H |
| InChIKey | DGCOGZQDAXUUBY-UHFFFAOYSA-N |
| SMILES | O1C2=CC=CC=C2OC1(F)F |
| LogP | 2.96 |
| CAS DataBase Reference | 1583-59-1(CAS DataBase Reference) |
Description and Uses
2,2-Difluoro-1,3-benzodioxole is used in the synthesis of Kv3 inhibitors as well as in the preparation of renin inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H335 |
| Precautionary statements | P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-43 |
| Safety Statements | 26-36/37/39-36/37 |
| RIDADR | UN1993 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 2932990090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
