3,3-Diethoxypropionic Acid Ethyl Ester , 95% , 10601-80-6
Synonym(s):
Malonaldehydic acid ethyl ester diethylacetal
CAS NO.:10601-80-6
Empirical Formula: C9H18O4
Molecular Weight: 190.24
MDL number: MFCD00009865
EINECS: 234-223-1
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB23.20 | In Stock |
|
| 10ML | RMB47.20 | In Stock |
|
| 25ML | RMB67.20 | In Stock |
|
| 50ML | RMB184.00 | In Stock |
|
| 100ML | RMB237.60 | In Stock |
|
| 250ML | RMB744.80 | In Stock |
|
| 500ML | RMB1103.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 200-202 °C |
| Boiling point: | 92-93 °C/13 mmHg (lit.) |
| Density | 0.978 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 184 °F |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Clear colorless |
| BRN | 1772110 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C9H18O4/c1-4-11-8(10)7-9(12-5-2)13-6-3/h9H,4-7H2,1-3H3 |
| InChIKey | SIALOQYKFQEKOG-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)CC(OCC)OCC |
| LogP | 2.260 (est) |
| CAS DataBase Reference | 10601-80-6(CAS DataBase Reference) |
Description and Uses
Ethyl 3,3-diethoxypropionate is an organic compound that is synthesized from the reaction of diethyl malonate and chloroacetic acid in the presence of a base catalyst. This product has been shown to be an effective inhibitor of mitochondrial cytochrome c oxidase in vitro studies. Ethyl 3,3-diethoxypropionate also has been found to inhibit quinoline derivatives, such as erythromycin and tetracycline, which are involved in bacterial DNA synthesis. Furthermore, this product inhibits β-unsaturated aldehydes and allylation.
Ethyl 3,3-diethoxypropionate participates in the Yb(OTf)3 catalyzed synthesis of dihydropyridines (DHPs).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210e-P280a-P370+P378a-P501a-P210-P280-P370+P378-P403+P235-P501 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29189900 |
| Storage Class | 10 - Combustible liquids |






