A5580412
Methyl dimethoxyacetate , ≥95% , 89-91-8
Synonym(s):
Glyoxylic acid methyl ester dimethyl acetal
CAS NO.:89-91-8
Empirical Formula: C5H10O4
Molecular Weight: 134.13
MDL number: MFCD00008484
EINECS: 201-950-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB36.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 67 °C/18 mmHg (lit.) |
| Density | 1.096 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 146 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Liquid |
| color | Clear colorless to very slightly yellow |
| Sensitive | Moisture Sensitive |
| BRN | 1757582 |
| InChI | InChI=1S/C5H10O4/c1-7-4(6)5(8-2)9-3/h5H,1-3H3 |
| InChIKey | NZTCVGHPDWAALP-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C(OC)OC |
| CAS DataBase Reference | 89-91-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Acetic acid, dimethoxy-, methyl ester(89-91-8) |
| EPA Substance Registry System | Acetic acid, dimethoxy-, methyl ester (89-91-8) |
Description and Uses
Methyl dimethoxyacetate has been used:
- in Claisen acylation of active hydrogen compounds
- in preparation of 3, 9-disubstituted 2,4,8,10-tetroxaspiro [5.5] undecane
- as Lithium enolate precursor
- as acylating reagent for cycloalkanone enolates and amino alcohols
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210-P280-P403+P235-P501-P210e-P280a-P370+P378a-P501a |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29189900 |
| Storage Class | 10 - Combustible liquids |






