A5364512
Methyl 3,3-dimethoxypropionate , 97% , 7424-91-1
CAS NO.:7424-91-1
Empirical Formula: C6H12O4
Molecular Weight: 148.16
MDL number: MFCD00010650
EINECS: 231-055-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB36.80 | In Stock |
|
| 10g | RMB65.60 | In Stock |
|
| 25G | RMB104.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 77 °C/20 mmHg (lit.) |
| Density | 1.045 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 150 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Liquid |
| color | Clear colorless |
| BRN | 1561517 |
| InChI | InChI=1S/C6H12O4/c1-8-5(7)4-6(9-2)10-3/h6H,4H2,1-3H3 |
| InChIKey | SMCVPMKCDDNUCQ-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)CC(OC)OC |
| CAS DataBase Reference | 7424-91-1(CAS DataBase Reference) |
Description and Uses
Methyl β,β-Dimethoxypropionate is used as a reactant in the preparation of tetrahydro-β-carboline derivatives as antitumor growth and metastasis agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210e-P280a-P370+P378a-P501a-P210-P280-P370+P378-P403+P235-P501 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| HS Code | 29189900 |
| Storage Class | 10 - Combustible liquids |






