A3207112
2,3,5-DCTF , 98% , 69045-84-7
CAS NO.：69045-84-7
Empirical Formula: C6H2Cl2F3N
Molecular Weight: 215.99
MDL number: MFCD00042243
EINECS: 410-340-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB53.60 | In Stock |
|
| 100G | RMB145.60 | In Stock |
|
| 500g | RMB648.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 8-9 °C |
| Boiling point: | 80 °C20 mm Hg(lit.) |
| Density | 1.549 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 175 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Chloroform, Methanol |
| pka | -3.34±0.10(Predicted) |
| form | Liquid |
| Specific Gravity | 1.549 |
| color | Clear colorless to yellow |
| InChI | InChI=1S/C6H2Cl2F3N/c7-4-1-3(6(9,10)11)2-12-5(4)8/h1-2H |
| InChIKey | ABNQGNFVSFKJGI-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(C(F)(F)F)C=C1Cl |
| CAS DataBase Reference | 69045-84-7(CAS DataBase Reference) |
| EPA Substance Registry System | 2,3-Dichloro-5-(trifluoromethyl)pyridine (69045-84-7) |
Description and Uses
2,3-Dichloro-5-(trifluoromethyl)pyridine is a reactant that has been used in the synthesis of a 17b-HSD1 inhibitor.
Safety
| Symbol(GHS) |    GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H302+H332-H317-H318-H411 |
| Precautionary statements | P273-P280-P301+P312-P302+P352-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,N,Xi |
| Risk Statements | 20/22-41-43-51/53-36/37/38 |
| Safety Statements | 24-26-37/39-61-36 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 2 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29333990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
