A3213912
N-Decanoyl-N-methylglucamine , High -level , 85261-20-7
Synonym(s):
N-(D -Glucityl)-N-methyldecanamide;N-Decanoyl-N-methyl-D -glucamine;MEGA-10;N-decanoyl-N-methylglucamine
CAS NO.:85261-20-7
Empirical Formula: C17H35NO6
Molecular Weight: 349.46
MDL number: MFCD00036801
EINECS: 617-695-7
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB199.20 | In Stock |
|
| 1G | RMB535.20 | In Stock |
|
| 5G | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 91-93 °C |
| Boiling point: | 595.8±50.0 °C(Predicted) |
| Density | 1.155±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | H2O: 10 mg/mL at 20 °C, clear, colorless |
| pka | 13.44±0.20(Predicted) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | Soluble in methanol at 50mg/ml. Also soluble in water at 10mg/ml 20 °C |
| BRN | 6974359 |
| InChI | 1S/C17H35NO6/c1-3-4-5-6-7-8-9-10-15(22)18(2)11-13(20)16(23)17(24)14(21)12-19/h13-14,16-17,19-21,23-24H,3-12H2,1-2H3 |
| InChIKey | UMWKZHPREXJQGR-UHFFFAOYSA-N |
| SMILES | OCC(O)C(O)C(O)C(O)CN(C)C(CCCCCCCCC)=O |
| EPA Substance Registry System | N-Oxodecyl meglumine (85261-20-7) |
Description and Uses
Non-ionic detergent for solubilizing membrane proteins
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-24/25-37/39-36-26 |
| WGK Germany | 3 |
| F | 3-9 |
| Storage Class | 11 - Combustible Solids |







