A3368412
6-(Dimethylamino)-1-hexanol , ≥97.0%(GC) , 1862-07-3
CAS NO.:1862-07-3
Empirical Formula: C8H19NO
Molecular Weight: 145.24
MDL number: MFCD00046028
EINECS: 404-680-3
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB60.00 | In Stock |
|
| 5ml | RMB157.68 | In Stock |
|
| 25ML | RMB515.20 | In Stock |
|
| 100ml | RMB1575.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 117 °C / 12mmHg |
| Density | 0,88 g/cm3 |
| refractive index | 1.4460-1.4500 |
| storage temp. | Refrigerator |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| pka | 15.19±0.10(Predicted) |
| form | Oil |
| color | Colourless Liquid |
| InChI | InChI=1S/C8H19NO/c1-9(2)7-5-3-4-6-8-10/h10H,3-8H2,1-2H3 |
| InChIKey | QCXNXRUTKSIZND-UHFFFAOYSA-N |
| SMILES | C(O)CCCCCN(C)C |
| EPA Substance Registry System | 1-Hexanol, 6-(dimethylamino)- (1862-07-3) |
Description and Uses
An alkanolamine as lysosomotropic agent and choline uptake inhibitor.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314-H412 |
| Precautionary statements | P260-P264-P270-P273-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P405-P501 |
| Hazard Codes | C |
| Risk Statements | 10-20/21/22-34-52/53-22 |
| Safety Statements | 16-26-36/37/39-45-61 |
| RIDADR | 2733 |
| TSCA | TSCA listed |
| HS Code | 2922.19.7000 |
| HazardClass | 8 |
| PackingGroup | II |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







