A3218112
4,5-Difluoro-2-nitrobenzoic acid , 98% , 20372-63-8
CAS NO.:20372-63-8
Empirical Formula: C7H3F2NO4
Molecular Weight: 203.1
MDL number: MFCD00799521
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.80 | In Stock |
|
| 5G | RMB40.80 | In Stock |
|
| 25G | RMB152.00 | In Stock |
|
| 100G | RMB494.40 | In Stock |
|
| 500g | RMB2041.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165-167 °C (lit.) |
| Boiling point: | 349.7±42.0 °C(Predicted) |
| Density | 1.661±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 1.85±0.25(Predicted) |
| color | White to Light yellow |
| InChI | 1S/C7H3F2NO4/c8-4-1-3(7(11)12)6(10(13)14)2-5(4)9/h1-2H,(H,11,12) |
| InChIKey | HGGRAOYTQNFGGN-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cc(F)c(F)cc1[N+]([O-])=O |
| CAS DataBase Reference | 20372-63-8(CAS DataBase Reference) |
Description and Uses
4,5-Difluoro-2-nitrobenzoic acid can be obtained from the nitration of 4,5-difluorobenzoic acid or 3,4-difluorobenzoic acid.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





