PRODUCT Properties
| Melting point: | 197-200 °C (dec.) |
| alpha | 14 º (c=3.7, H2O 16 ºC) |
| refractive index | 14.5 ° (C=3.6, H2O) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | water: soluble0.5g/10 mL |
| form | Solid |
| color | White to Off-White |
| optical activity | [α]20/D +14.5±1.5°, c = 3.67% in H2O |
| Water Solubility | very faint turbidity |
| BRN | 5763078 |
| InChI | InChI=1S/C4H10N2O2.2ClH/c5-2-1-3(6)4(7)8;;/h3H,1-2,5-6H2,(H,7,8);2*1H |
| InChIKey | CKAAWCHIBBNLOJ-UHFFFAOYSA-N |
| SMILES | C(N)(C(=O)O)CCN.Cl.Cl |
| CAS DataBase Reference | 1883-09-6(CAS DataBase Reference) |
Description and Uses
L-2,4-Diaminobutyric acid dihydrochloride is suitable reagent used for the differentiation of β-N-methylamino-L-alanine from the diamino acids by using HPLC-FD, UHPLC-UV, UHPLC-MS, and triple quadrupole tandem mass spectrometry (UHPLC-MS/MS). It is suitable reagent used in the quantification of neurotoxin β-N-methylamino-L-alanine (BMAA) in seafood. It may be used as Internal standard for amino acid analysis
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 37/38-41 |
| Safety Statements | 26-36/39-24/25 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 29224999 |
