A3221012
3,5-Dichlorosalicylaldehyde , 98% , 90-60-8
CAS NO.:90-60-8
Empirical Formula: C7H4Cl2O2
Molecular Weight: 191.01
MDL number: MFCD00003320
EINECS: 202-005-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB46.40 | In Stock |
|
| 25G | RMB104.80 | In Stock |
|
| 100G | RMB376.80 | In Stock |
|
| 500g | RMB1864.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 95-97 °C (lit.) |
| Boiling point: | 273.68°C (rough estimate) |
| Density | 1.4410 (rough estimate) |
| refractive index | 1.4590 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | ethanol: soluble5%, clear, faintly yellow to greenish-yellow |
| pka | 6.27±0.23(Predicted) |
| form | Crystalline Powder |
| color | Pale yellow |
| Water Solubility | Insoluble in water. Solubility in methanol is almost transparent. |
| Sensitive | Air Sensitive |
| BRN | 973391 |
| InChI | InChI=1S/C7H4Cl2O2/c8-5-1-4(3-10)7(11)6(9)2-5/h1-3,11H |
| InChIKey | FABVMBDCVAJXMB-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(Cl)=CC(Cl)=C1O |
| CAS DataBase Reference | 90-60-8(CAS DataBase Reference) |
| EPA Substance Registry System | Benzaldehyde, 3,5-dichloro-2-hydroxy- (90-60-8) |
Description and Uses
3,5-Dichlorosalicylaldehyde has been used in the preparation of:
- Schiff base ligands
- (RS)-3,5-dichloro-2-[[(1-phenylethyl)imino]methyl]phenol
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29121900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






![Bis[3,4,6-trichloro-2-(pentyloxycarbonyl)phenyl] Oxalate](https://img.chemicalbook.com/CAS/GIF/30431-54-0.gif)