A3226812
Dichlorprop , Analysis standard , 120-36-5
Synonym(s):
2-(2,4-Dichlorophenoxy)propionic acid
CAS NO.:120-36-5
Empirical Formula: C9H8Cl2O3
Molecular Weight: 235.06
MDL number: MFCD00002645
EINECS: 204-390-5
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 110-112 °C(lit.) |
| Boiling point: | 335.78°C (rough estimate) |
| Density | 1.3965 (rough estimate) |
| refractive index | 1.5000 (estimate) |
| storage temp. | APPROX 4°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 3.03±0.10(Predicted) |
| color | Off-White to Pale Beige |
| Water Solubility | 829mg/L(25 ºC) |
| Merck | 14,3078 |
| BRN | 2213812 |
| InChI | InChI=1S/C9H8Cl2O3/c1-5(9(12)13)14-8-3-2-6(10)4-7(8)11/h2-5H,1H3,(H,12,13) |
| InChIKey | MZHCENGPTKEIGP-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(OC1=CC=C(Cl)C=C1Cl)C |
| CAS DataBase Reference | 120-36-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Alpha-(2,4-dichlorophenoxy)propionic acid(120-36-5) |
| EPA Substance Registry System | Dichlorprop (120-36-5) |
Description and Uses
2,4-DP is a combustible, colorless to yellowishto tan crystalline solid with a faint phenolic odor; Molecularweight=235.07; Freezing/Melting point=117-118℃.Soluble in water; solubility=350 mg/L at 20℃. HazardIdentification (based on NFPA-704 M Rating System):Health 2, Flammability 0, Reactivity 0. May be applied as aliquid formulated with a flammable carrier, which can alterthe physical properties listed here.
Dichloroprop is a herbicide used for the post-emergence control of annual and perennial broad-leaved weeds and some brush species.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H312-H315-H318 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 21/22-38-41-36/37/38-20/21/22 |
| Safety Statements | 26-36/37-37/39 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 2 |
| RTECS | UF1050000 |
| TSCA | Yes |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29189990 |
| Hazardous Substances Data | 120-36-5(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: 344mg/kg |







