A3233012
(1R,2R)-(+)-1,2-Diaminocyclohexane L-tartrate , 98% , 39961-95-0
CAS NO.:39961-95-0
Empirical Formula: C10H20N2O6
Molecular Weight: 264.28
MDL number: MFCD00191979
EINECS: 609-759-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB25.60 | In Stock |
|
| 5G | RMB40.80 | In Stock |
|
| 25G | RMB149.60 | In Stock |
|
| 100g | RMB466.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 273 °C (dec.)(lit.) |
| alpha | 12.5 º (c=4, H2O) |
| refractive index | 12 ° (C=2.5, H2O) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| optical activity | [α]20/D +12.5°, c = 4 in H2O |
| InChI | InChI=1/C6H14N2.C4H6O6/c7-5-3-1-2-4-6(5)8;5-1(3(7)8)2(6)4(9)10/h5-6H,1-4,7-8H2;1-2,5-6H,(H,7,8)(H,9,10)/t5-,6-;/s3 |
| InChIKey | GDOTUTAQOJUZOF-ATPDZTHWNA-N |
| SMILES | [C@@H]1(N)CCCC[C@H]1N.C(O)(=O)C(C(C(O)=O)O)O |&1:0,6,r| |
| CAS DataBase Reference | 39961-95-0(CAS DataBase Reference) |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29225090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |






![(R)-1-[3,5-Bis(trifluoromethyl)phenyl]ethanol](https://img.chemicalbook.com/CAS/GIF/127852-28-2.gif)
