A7333312
(1S,2S)-(-)-1,2-Diaminocyclohexane D-tartrate , 98% , 67333-70-4
CAS NO.:67333-70-4
Empirical Formula: C10H20N2O6
Molecular Weight: 264.28
MDL number: MFCD00191980
EINECS: 614-051-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB44.00 | In Stock |
|
| 25G | RMB184.80 | In Stock |
|
| 100g | RMB655.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 280-284 °C (dec.)(lit.) |
| alpha | -12.5 º (c=4, H2O) |
| refractive index | -13 ° (C=2.5, H2O) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| optical activity | [α]20/D 12.5°, c = 4 in H2O |
| InChI | InChI=1/C6H14N2.C4H6O6/c7-5-3-1-2-4-6(5)8;5-1(3(7)8)2(6)4(9)10/h5-6H,1-4,7-8H2;1-2,5-6H,(H,7,8)(H,9,10)/t5-,6-;1-,2-/s3 |
| InChIKey | GDOTUTAQOJUZOF-GSCHLEBDNA-N |
| SMILES | [C@@H](O)(C(O)=O)[C@H](O)C(=O)O.[C@H]1(N)CCCC[C@@H]1N |&1:0,5,10,16,r| |
| CAS DataBase Reference | 67333-70-4(CAS DataBase Reference) |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| HS Code | 29213000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |







![(R)-1-[3,5-Bis(trifluoromethyl)phenyl]ethanol](https://img.chemicalbook.com/CAS/GIF/127852-28-2.gif)