PRODUCT Properties
| Melting point: | 55-57 °C (lit.) |
| Boiling point: | 264.9±35.0 °C(Predicted) |
| Density | 1.6589 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Insoluble in water |
| form | powder to crystal |
| color | Light yellow to Yellow to Orange |
| BRN | 2467459 |
| InChI | InChI=1S/C7H2Cl2F3NO2/c8-4-2-5(9)6(13(14)15)1-3(4)7(10,11)12/h1-2H |
| InChIKey | VLVNHMVSVDVAOA-UHFFFAOYSA-N |
| SMILES | C(F)(F)(F)C1=CC([N+]([O-])=O)=C(Cl)C=C1Cl |
| CAS DataBase Reference | 400-70-4(CAS DataBase Reference) |
Description and Uses
2,4-Dichloro-5-nitrobenzotrifluoride has been used in the synthesis of:
- 2-substituted 3,7,8-trichlorodibenzo-p-dioxins
- new substituted 10 H-phenothiazines
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-37/39-36/37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT, IRRITANT-HARMFUL |
| HS Code | 29049090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
