A3260812
2,4-Dimethoxyprimidine-5-boronic acid , 98% , 89641-18-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB69.60 | In Stock |
|
| 5G | RMB227.20 | In Stock |
|
| 25g | RMB794.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 113-117 °C |
| Boiling point: | 420.6±55.0 °C(Predicted) |
| Density | 1.33±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 5.62±0.58(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C6H9BN2O4/c1-12-5-4(7(10)11)3-8-6(9-5)13-2/h3,10-11H,1-2H3 |
| InChIKey | LKGKUACPLXCVOF-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(OC)N=C1OC)(O)O |
| CAS DataBase Reference | 89641-18-9(CAS DataBase Reference) |
Description and Uses
2,4-Dimethoxypyrimidine-5-boronic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT, KEEP COLD |
| HS Code | 2933599590 |
| Storage Class | 11 - Combustible Solids |






