PRODUCT Properties
| Melting point: | 28-32 °C (lit.) |
| Boiling point: | 150-155 °C/15 mmHg (lit.) |
| Density | 1.0613 (rough estimate) |
| refractive index | 1.5485-1.5505 |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Soluble in ethanol, benzene, chloroform. |
| form | Liquid After Melting |
| color | Clear slightly yellow |
| BRN | 2042511 |
| InChI | InChI=1S/C10H10O2/c1-7(11)9-4-3-5-10(6-9)8(2)12/h3-6H,1-2H3 |
| InChIKey | VCHOFVSNWYPAEF-UHFFFAOYSA-N |
| SMILES | C1(C(=O)C)=CC=CC(C(=O)C)=C1 |
| CAS DataBase Reference | 6781-42-6(CAS DataBase Reference) |
Description and Uses
1,3-Diacetylbenzene was used in the preparation of polyhydroxylated analogs. It is an important raw material and intermediates in organic synthesis.
