A3291112
5,6-Dichloronicotinic acid , 98% , 41667-95-2
Synonym(s):
5,6-Dichloronicotinic acid;5,6-Dichloropyridine-3-carboxylic acid
CAS NO.:41667-95-2
Empirical Formula: C6H3Cl2NO2
Molecular Weight: 192
MDL number: MFCD00075181
EINECS: 609-951-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB56.00 | In Stock |
|
| 25G | RMB217.60 | In Stock |
|
| 100g | RMB1320.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 164-168 °C(lit.) |
| Boiling point: | 342.1±37.0 °C(Predicted) |
| Density | 1.612±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 2.87±0.10(Predicted) |
| form | Powder |
| color | White to beige to tan |
| BRN | 383740 |
| InChI | InChI=1S/C6H3Cl2NO2/c7-4-1-3(6(10)11)2-9-5(4)8/h1-2H,(H,10,11) |
| InChIKey | RNRLTTNKVLFZJS-UHFFFAOYSA-N |
| SMILES | C1=NC(Cl)=C(Cl)C=C1C(O)=O |
| CAS DataBase Reference | 41667-95-2(CAS DataBase Reference) |
Description and Uses
5,6-Dichloronicotinic acid is a dihalonicotinic acid. It is used in the preparation of 5-chloro-6-iodonicotinic acid by iodine displacement.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |







