A5393012
2-Mercaptonicotinic acid , 99% , 38521-46-9
Synonym(s):
2-Mercaptonicotinic acid
CAS NO.:38521-46-9
Empirical Formula: C6H5NO2S
Molecular Weight: 155.17
MDL number: MFCD00010102
EINECS: 629-602-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB28.80 | In Stock |
|
| 25G | RMB96.80 | In Stock |
|
| 100G | RMB297.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 263-265 °C(lit.) |
| Boiling point: | 295.3±50.0 °C(Predicted) |
| Density | 1.357 (estimate) |
| refractive index | 1.5380 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 1.98±0.20(Predicted) |
| form | crystalline (fine) |
| color | yellow |
| Sensitive | Air Sensitive |
| BRN | 119029 |
| InChI | InChI=1S/C6H5NO2S/c8-6(9)4-2-1-3-7-5(4)10/h1-3H,(H,7,10)(H,8,9) |
| InChIKey | WYKHFQKONWMWQM-UHFFFAOYSA-N |
| SMILES | C1(=S)NC=CC=C1C(O)=O |
| CAS DataBase Reference | 38521-46-9(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Mercaptonicotinic acid (38521-46-9) |
Description and Uses
2-Mercaptopyridine-3-carboxylic acid may be used for the synthesis of poly[[diaquabis([μ]2-4,4 ′-bipyridyl)iron(II)] bis{2-[(3-carboxypyridin-2-yl)disulfanyl]nicotinate}] and 2-(2-carboxyethylthio)nicotinic acid.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| F | 10-23 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







