A0701612
6-Aminonicotinic acid , 98% , 3167-49-5
Synonym(s):
6-Aminonicotinic acid
CAS NO.:3167-49-5
Empirical Formula: C6H6N2O2
Molecular Weight: 138.12
MDL number: MFCD00006326
EINECS: 221-630-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB25.60 | In Stock |
|
| 5G | RMB36.80 | In Stock |
|
| 25G | RMB122.40 | In Stock |
|
| 100G | RMB435.20 | In Stock |
|
| 500g | RMB2136.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C (lit.) |
| Boiling point: | 253.51°C (rough estimate) |
| Density | 1.3471 (rough estimate) |
| refractive index | 1.5100 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Powder |
| pka | 2.86±0.10(Predicted) |
| color | White to beige |
| Water Solubility | ca 1.0 g/L (20 ºC) |
| Merck | 14,456 |
| BRN | 115992 |
| InChI | InChI=1S/C6H6N2O2/c7-5-2-1-4(3-8-5)6(9)10/h1-3H,(H2,7,8)(H,9,10) |
| InChIKey | ZCIFWRHIEBXBOY-UHFFFAOYSA-N |
| SMILES | C1=NC(N)=CC=C1C(O)=O |
| CAS DataBase Reference | 3167-49-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Nicotinic acid, 6-amino-(3167-49-5) |
| EPA Substance Registry System | 3-Pyridinecarboxylic acid, 6-amino- (3167-49-5) |
Description and Uses
6-Aminopyridine-3-carboxylic acid (6-Aminonicotinic acid) was used in the preparation of resin-bound 2-aminoazine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-23/24/25 |
| Safety Statements | 22-24/25-45-36/37/39-26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |







