A3303412
2,3-Difluorophenetole , 98%(GC) , 121219-07-6
CAS NO.：121219-07-6
Empirical Formula: C8H8F2O
Molecular Weight: 158.15
MDL number: MFCD07368737
EINECS: 441-000-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB28.80 | In Stock |
|
| 25G | RMB82.40 | In Stock |
|
| 100G | RMB309.60 | In Stock |
|
| 500g | RMB1407.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 178 |
| Density | 1.1784 |
| vapor pressure | 4.13hPa at 20℃ |
| refractive index | 1.4670-1.4710 |
| Flash point: | 70.5 |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow |
| Water Solubility | 254mg/L at 20℃ |
| InChI | InChI=1S/C8H8F2O/c1-2-11-7-5-3-4-6(9)8(7)10/h3-5H,2H2,1H3 |
| InChIKey | AVOGLGBKOFOSBN-UHFFFAOYSA-N |
| SMILES | C1(OCC)=CC=CC(F)=C1F |
| LogP | 2.82 at 23℃ |
| CAS DataBase Reference | 121219-07-6(CAS DataBase Reference) |
Description and Uses
2,3-Difluoroethoxybenzene is a liquid that can be used as a synthetic intermediate for pharmaceutical molecules and liquid crystal materials.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H302-H412 |
| Precautionary statements | P210-P264-P270-P273-P280-P301+P312+P330-P403+P235-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37 |
| HS Code | 29093090 |
