A6879712
Pentafluorophenyl Acrylate , >98.0%(GC) , 71195-85-2
Synonym(s):
2-Propenoic acid pentafluorophenyl ester
| Pack Size | Price | Stock | Quantity |
| 1G | RMB322.56 | In Stock |
|
| 5G | RMB755.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 145-149°C |
| Density | 1.446 |
| refractive index | n/D1.434 |
| Flash point: | 68℃ |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Light yellow |
| λmax | 256nm(Hexane)(lit.) |
| InChI | InChI=1S/C9H3F5O2/c1-2-3(15)16-9-7(13)5(11)4(10)6(12)8(9)14/h2H,1H2 |
| InChIKey | RFOWDPMCXHVGET-UHFFFAOYSA-N |
| SMILES | C(OC1=C(F)C(F)=C(F)C(F)=C1F)(=O)C=C |
Description and Uses
Pentafluorophenyl acrylate may be used in the preparation of highly porous polymers (poly HIPs). Pentafluorophenyl acrylate (PFPA) can undergo reversible addition fragmentation transfer (RAFT) polymerization with oligoethylene glycol acrylate (OEGA) or diethylene glycol acrylate (DEGA).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29161290 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






